Bioactivity:Asperphenamate is a fungal metabolite of Aspergillus flatiipes with anti-cancer effect (IC50s: 92.3 _M, 96.5 _M, and 97.9 _M in T47D, MDA-MB-231, and HL-60 cells).
CAS Nr:
63631-36-7
Purity:
98%
SMILES:
O=C(OC[C@@H](NC(C1=CC=CC=C1)=O)CC2=CC=CC=C2)[C@H](CC3=CC=CC=C3)NC(C4=CC=CC=C4)=O
Formula:
C32H30N2O4
Molecular weight:
506,59
Pathway:
Others
Target:
Others